C26H48O8 — CID 157185741
[(3S,4S,6R)-6-[(3S,4R,6R)-2-(hydroxymethyl)-6-[(3S,4R)-2-(hydroxymethyl)-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methanol (PubChem CID 157185741) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is [(3S,4S,6R)-6-[(3S,4R,6R)-2-(hydroxymethyl)-6-[(3S,4R)-2-(hydroxymethyl)-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methanol.
| Compound Name | [(3S,4S,6R)-6-[(3S,4R,6R)-2-(hydroxymethyl)-6-[(3S,4R)-2-(hydroxymethyl)-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 157185741 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [(3S,4S,6R)-6-[(3S,4R,6R)-2-(hydroxymethyl)-6-[(3S,4R)-2-(hydroxymethyl)-4,5,6-trimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methanol |
| SMILES | CC1OC(CO)[C@@H](O[C@@H]2OC(CO)[C@@H](O[C@H]3OC(CO)[C@@H](C)[C@H](C)C3C)[C@H](C)C2C)[C@H](C)C1C |
| InChI | InChI=1S/C26H48O8/c1-12-14(3)20(9-27)31-25(17(12)6)34-24-16(5)18(7)26(32-22(24)11-29)33-23-15(4)13(2)19(8)30-21(23)10-28/h12-29H,9-11H2,1-8H3/t12-,13?,14-,15+,16+,17?,18?,19?,20?,21?,22?,23-,24-,25+,26-/m0/s1 |
| InChIKey | GOZJNETYMOBYHF-BELCQXOQSA-N |
| XLogP | 2.42 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |