C11H22O2 — CID 159477864
(3S,5S,6R)-2-ethyl-3-methoxy-4,5,6-trimethyloxane (PubChem CID 159477864) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (3S,5S,6R)-2-ethyl-3-methoxy-4,5,6-trimethyloxane.
| Compound Name | (3S,5S,6R)-2-ethyl-3-methoxy-4,5,6-trimethyloxane |
|---|---|
| PubChem CID | 159477864 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3S,5S,6R)-2-ethyl-3-methoxy-4,5,6-trimethyloxane |
| SMILES | CCC1O[C@H](C)[C@@H](C)C(C)[C@@H]1OC |
| InChI | InChI=1S/C11H22O2/c1-6-10-11(12-5)8(3)7(2)9(4)13-10/h7-11H,6H2,1-5H3/t7-,8?,9+,10?,11-/m0/s1 |
| InChIKey | LWPRLFXIDFVCRE-PPDVERPWSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |