C11H22O — CID 91273556
(3S,4R,6S)-2-ethyl-3,4,5,6-tetramethyloxane (PubChem CID 91273556) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (3S,4R,6S)-2-ethyl-3,4,5,6-tetramethyloxane.
| Compound Name | (3S,4R,6S)-2-ethyl-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 91273556 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (3S,4R,6S)-2-ethyl-3,4,5,6-tetramethyloxane |
| SMILES | CCC1O[C@@H](C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H22O/c1-6-11-9(4)7(2)8(3)10(5)12-11/h7-11H,6H2,1-5H3/t7-,8?,9+,10+,11?/m1/s1 |
| InChIKey | QXGXZFCIOMNNOY-HHQHDOLHSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |