C9H18O3 — CID 59046301
(2S,4S,5R)-6-ethyl-2,5-dimethyloxane-3,4-diol (PubChem CID 59046301) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,4S,5R)-6-ethyl-2,5-dimethyloxane-3,4-diol.
| Compound Name | (2S,4S,5R)-6-ethyl-2,5-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 59046301 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (2S,4S,5R)-6-ethyl-2,5-dimethyloxane-3,4-diol |
| SMILES | CCC1O[C@@H](C)C(O)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C9H18O3/c1-4-7-5(2)8(10)9(11)6(3)12-7/h5-11H,4H2,1-3H3/t5-,6-,7?,8-,9?/m0/s1 |
| InChIKey | AZYTTWJPFAAKPU-NUPYAZKJSA-N |
| XLogP | 0.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |