C7H14O3 — CID 21338247
5-ethyl-4-methyloxolane-2,3-diol (PubChem CID 21338247) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-ethyl-4-methyloxolane-2,3-diol.
| Compound Name | 5-ethyl-4-methyloxolane-2,3-diol |
|---|---|
| PubChem CID | 21338247 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 5-ethyl-4-methyloxolane-2,3-diol |
| SMILES | CCC1OC(O)C(O)C1C |
| InChI | InChI=1S/C7H14O3/c1-3-5-4(2)6(8)7(9)10-5/h4-9H,3H2,1-2H3 |
| InChIKey | WNUWDHOWKZHDQF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |