C8H16AcO2 — CID 59063588
actinium;(2S,3R,5S)-5-ethyl-3,4-dimethyloxolan-2-ol (PubChem CID 59063588) has the molecular formula C8H16AcO2 and a molecular weight of 371.21 g/mol. Its IUPAC name is actinium;(2S,3R,5S)-5-ethyl-3,4-dimethyloxolan-2-ol.
| Compound Name | actinium;(2S,3R,5S)-5-ethyl-3,4-dimethyloxolan-2-ol |
|---|---|
| PubChem CID | 59063588 |
| Molecular Formula | C8H16AcO2 |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | actinium;(2S,3R,5S)-5-ethyl-3,4-dimethyloxolan-2-ol |
| SMILES | CC[C@@H]1O[C@H](O)[C@H](C)C1C.[Ac] |
| InChI | InChI=1S/C8H16O2.Ac/c1-4-7-5(2)6(3)8(9)10-7;/h5-9H,4H2,1-3H3;/t5?,6-,7+,8+;/m1./s1 |
| InChIKey | FHKPVPHDNHYLCA-CAXFZPNWSA-N |
| XLogP | 1.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |