C12H24O3 — CID 126764279
(2R,4S,5R)-6-ethyl-3,5-dimethyl-4-propan-2-yloxyoxan-2-ol (PubChem CID 126764279) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R,4S,5R)-6-ethyl-3,5-dimethyl-4-propan-2-yloxyoxan-2-ol.
| Compound Name | (2R,4S,5R)-6-ethyl-3,5-dimethyl-4-propan-2-yloxyoxan-2-ol |
|---|---|
| PubChem CID | 126764279 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (2R,4S,5R)-6-ethyl-3,5-dimethyl-4-propan-2-yloxyoxan-2-ol |
| SMILES | CCC1O[C@@H](O)C(C)[C@@H](OC(C)C)[C@@H]1C |
| InChI | InChI=1S/C12H24O3/c1-6-10-8(4)11(14-7(2)3)9(5)12(13)15-10/h7-13H,6H2,1-5H3/t8-,9?,10?,11+,12-/m1/s1 |
| InChIKey | PSRQHEAVZARODL-QPCJGGDKSA-N |
| XLogP | 2.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |