C13H26O2 — CID 58794899
(2R,4R,5R)-2-ethyl-3,4,5-trimethyl-6-propan-2-yloxyoxane (PubChem CID 58794899) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (2R,4R,5R)-2-ethyl-3,4,5-trimethyl-6-propan-2-yloxyoxane.
| Compound Name | (2R,4R,5R)-2-ethyl-3,4,5-trimethyl-6-propan-2-yloxyoxane |
|---|---|
| PubChem CID | 58794899 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (2R,4R,5R)-2-ethyl-3,4,5-trimethyl-6-propan-2-yloxyoxane |
| SMILES | CC[C@H]1OC(OC(C)C)[C@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C13H26O2/c1-7-12-10(5)9(4)11(6)13(15-12)14-8(2)3/h8-13H,7H2,1-6H3/t9-,10?,11-,12-,13?/m1/s1 |
| InChIKey | BLWWMZFQISPWCL-XTFRJMTMSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |