C12H24O6S — CID 158368042
[(3S,6R)-3,4,5-trimethyl-6-propan-2-yloxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 158368042) has the molecular formula C12H24O6S and a molecular weight of 296.39 g/mol. Its IUPAC name is [(3S,6R)-3,4,5-trimethyl-6-propan-2-yloxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(3S,6R)-3,4,5-trimethyl-6-propan-2-yloxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 158368042 |
| Molecular Formula | C12H24O6S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(3S,6R)-3,4,5-trimethyl-6-propan-2-yloxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(C)O[C@@H]1OC(COS(=O)(=O)O)[C@@H](C)C(C)C1C |
| InChI | InChI=1S/C12H24O6S/c1-7(2)17-12-10(5)8(3)9(4)11(18-12)6-16-19(13,14)15/h7-12H,6H2,1-5H3,(H,13,14,15)/t8?,9-,10?,11?,12+/m0/s1 |
| InChIKey | GUGQXAYDTXZZAC-AYQOGSFCSA-N |
| XLogP | 1.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|