C18H32O11S — CID 59042881
[(2R,3S,6S)-6-methoxy-3-[(2R,5S,6R)-5-methoxy-3,4-dimethyl-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dimethyloxan-2-yl] formate (PubChem CID 59042881) has the molecular formula C18H32O11S and a molecular weight of 456.51 g/mol. Its IUPAC name is [(2R,3S,6S)-6-methoxy-3-[(2R,5S,6R)-5-methoxy-3,4-dimethyl-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dimethyloxan-2-yl] formate.
| Compound Name | [(2R,3S,6S)-6-methoxy-3-[(2R,5S,6R)-5-methoxy-3,4-dimethyl-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dimethyloxan-2-yl] formate |
|---|---|
| PubChem CID | 59042881 |
| Molecular Formula | C18H32O11S |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [(2R,3S,6S)-6-methoxy-3-[(2R,5S,6R)-5-methoxy-3,4-dimethyl-6-(sulfooxymethyl)oxan-2-yl]oxy-4,5-dimethyloxan-2-yl] formate |
| SMILES | CO[C@H]1O[C@H](OC=O)[C@@H](O[C@H]2O[C@H](COS(=O)(=O)O)[C@@H](OC)C(C)C2C)C(C)C1C |
| InChI | InChI=1S/C18H32O11S/c1-9-12(4)17(27-13(14(9)23-5)7-26-30(20,21)22)28-15-10(2)11(3)16(24-6)29-18(15)25-8-19/h8-18H,7H2,1-6H3,(H,20,21,22)/t9?,10?,11?,12?,13-,14+,15+,16+,17-,18+/m1/s1 |
| InChIKey | HUQWNJAHVZPWJI-RJHYWNNPSA-N |
| XLogP | 0.98 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|