C12H22O31S7 — CID 87746469
[(2R,3S,4R,5S)-2,5-bis(sulfooxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxolan-3-yl] hydrogen sulfate (PubChem CID 87746469) has the molecular formula C12H22O31S7 and a molecular weight of 886.75 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,5-bis(sulfooxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxolan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5S)-2,5-bis(sulfooxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxolan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 87746469 |
| Molecular Formula | C12H22O31S7 |
| Molecular Weight | 886.75 g/mol |
| Exact Mass | 885.82 |
| IUPAC Name | [(2R,3S,4R,5S)-2,5-bis(sulfooxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyoxolan-3-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@@H]1O[C@H](COS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@@H]1O[C@@H]1O[C@H](COS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C12H22O31S7/c13-44(14,15)34-1-4-7(8(40-47(22,23)24)5(37-4)2-35-45(16,17)18)39-12-11(43-50(31,32)33)10(42-49(28,29)30)9(41-48(25,26)27)6(38-12)3-36-46(19,20)21/h4-12H,1-3H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33)/t4-,5+,6+,7+,8-,9-,10-,11+,12-/m0/s1 |
| InChIKey | CBZYSGRAXOCJBT-BSJBRCJESA-N |
| XLogP | -5.93 |
| TPSA | 472.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.75 |
| LogP ≤ 5 | -5.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|