C12H22O26S6 — CID 166766414
[(2R,3R,4S,5R)-5-[(3R,4R,5R)-3,4-disulfooxy-5-(sulfooxymethyl)cyclohexyl]oxy-3,4-disulfooxyoxolan-2-yl]methyl hydrogen sulfate (PubChem CID 166766414) has the molecular formula C12H22O26S6 and a molecular weight of 774.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[(3R,4R,5R)-3,4-disulfooxy-5-(sulfooxymethyl)cyclohexyl]oxy-3,4-disulfooxyoxolan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3R,4S,5R)-5-[(3R,4R,5R)-3,4-disulfooxy-5-(sulfooxymethyl)cyclohexyl]oxy-3,4-disulfooxyoxolan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 166766414 |
| Molecular Formula | C12H22O26S6 |
| Molecular Weight | 774.68 g/mol |
| Exact Mass | 773.87 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[(3R,4R,5R)-3,4-disulfooxy-5-(sulfooxymethyl)cyclohexyl]oxy-3,4-disulfooxyoxolan-2-yl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@H]1CC(O[C@@H]2O[C@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@@H]2OS(=O)(=O)O)C[C@@H](OS(=O)(=O)O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C12H22O26S6/c13-39(14,15)31-3-5-1-6(2-7(35-41(19,20)21)9(5)36-42(22,23)24)33-12-11(38-44(28,29)30)10(37-43(25,26)27)8(34-12)4-32-40(16,17)18/h5-12H,1-4H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)/t5-,6?,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | NEUDQTKDXOMGOG-GHWLEKRPSA-N |
| XLogP | -4.10 |
| TPSA | 400.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.68 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|