C12H24O38S9 — CID 11636750
[(1S,3R)-1-[(1S)-1,2-disulfooxyethyl]-3,4-disulfooxy-2-[(2S,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxybutyl] hydrogen sulfate (PubChem CID 11636750) has the molecular formula C12H24O38S9 and a molecular weight of 1064.89 g/mol. Its IUPAC name is [(1S,3R)-1-[(1S)-1,2-disulfooxyethyl]-3,4-disulfooxy-2-[(2S,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxybutyl] hydrogen sulfate.
| Compound Name | [(1S,3R)-1-[(1S)-1,2-disulfooxyethyl]-3,4-disulfooxy-2-[(2S,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxybutyl] hydrogen sulfate |
|---|---|
| PubChem CID | 11636750 |
| Molecular Formula | C12H24O38S9 |
| Molecular Weight | 1064.89 g/mol |
| Exact Mass | 1063.74 |
| IUPAC Name | [(1S,3R)-1-[(1S)-1,2-disulfooxyethyl]-3,4-disulfooxy-2-[(2S,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxybutyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C(O[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]1OS(=O)(=O)O)[C@@H](COS(=O)(=O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C12H24O38S9/c13-51(14,15)40-1-4-8(47-56(28,29)30)10(49-58(34,35)36)11(50-59(37,38)39)12(43-4)44-7(5(45-54(22,23)24)2-41-52(16,17)18)9(48-57(31,32)33)6(46-55(25,26)27)3-42-53(19,20)21/h4-12H,1-3H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33)(H,34,35,36)(H,37,38,39)/t4-,5-,6+,7?,8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | TYMJGCNHBGBYNJ-VASRJEDKSA-N |
| XLogP | -7.32 |
| TPSA | 590.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.89 |
| LogP ≤ 5 | -7.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 29 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|