C12H23O37S9- — CID 59022388
[(2S,3R,4R,5R)-3,4,5,6-tetrasulfooxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyhexan-2-yl] sulfite (PubChem CID 59022388) has the molecular formula C12H23O37S9- and a molecular weight of 1047.88 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4,5,6-tetrasulfooxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyhexan-2-yl] sulfite.
| Compound Name | [(2S,3R,4R,5R)-3,4,5,6-tetrasulfooxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyhexan-2-yl] sulfite |
|---|---|
| PubChem CID | 59022388 |
| Molecular Formula | C12H23O37S9- |
| Molecular Weight | 1047.88 g/mol |
| Exact Mass | 1046.74 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4,5,6-tetrasulfooxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trisulfooxy-6-(sulfooxymethyl)oxan-2-yl]oxyhexan-2-yl] sulfite |
| SMILES | O=S([O-])O[C@@H](CO[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]1OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@@H](COS(=O)(=O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C12H24O37S9/c13-50(14)43-5(8(46-55(27,28)29)9(47-56(30,31)32)6(44-53(21,22)23)3-41-52(18,19)20)1-39-12-11(49-58(36,37)38)10(48-57(33,34)35)7(45-54(24,25)26)4(42-12)2-40-51(15,16)17/h4-12H,1-3H2,(H,13,14)(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)(H,33,34,35)(H,36,37,38)/p-1/t4-,5+,6-,7-,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | FHKKXWJZVRYWDM-VNNZMYODSA-M |
| XLogP | -7.33 |
| TPSA | 576.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.88 |
| LogP ≤ 5 | -7.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 29 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|