C14H24Na2O17S2 — CID 10370866
disodium;[(2S,3R,4S,5S,6R)-5-hydroxy-4,6-dimethoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl sulfate (PubChem CID 10370866) has the molecular formula C14H24Na2O17S2 and a molecular weight of 574.44 g/mol. Its IUPAC name is disodium;[(2S,3R,4S,5S,6R)-5-hydroxy-4,6-dimethoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl sulfate.
| Compound Name | disodium;[(2S,3R,4S,5S,6R)-5-hydroxy-4,6-dimethoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 10370866 |
| Molecular Formula | C14H24Na2O17S2 |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | disodium;[(2S,3R,4S,5S,6R)-5-hydroxy-4,6-dimethoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl sulfate |
| SMILES | CO[C@@H]1O[C@@H](COS(=O)(=O)[O-])[C@@H](O[C@@H]2O[C@H](COS(=O)(=O)[O-])[C@H](O)[C@H](O)[C@H]2O)[C@@H](OC)[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C14H26O17S2.2Na/c1-25-12-10(18)13(26-2)30-6(4-28-33(22,23)24)11(12)31-14-9(17)8(16)7(15)5(29-14)3-27-32(19,20)21;;/h5-18H,3-4H2,1-2H3,(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2/t5-,6+,7+,8+,9-,10+,11-,12+,13-,14+;;/m1../s1 |
| InChIKey | KQMHHSXANSFMSK-ZZCFVWFOSA-L |
| XLogP | -11.11 |
| TPSA | 259.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | -11.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|