C10H19NaO8S — CID 71317197
sodium [(2S,4R,5R,6R)-4,5,6-trimethoxy-3-methyloxan-2-yl]methyl sulfate (PubChem CID 71317197) has the molecular formula C10H19NaO8S and a molecular weight of 322.31 g/mol. Its IUPAC name is sodium [(2S,4R,5R,6R)-4,5,6-trimethoxy-3-methyloxan-2-yl]methyl sulfate.
| Compound Name | sodium [(2S,4R,5R,6R)-4,5,6-trimethoxy-3-methyloxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 71317197 |
| Molecular Formula | C10H19NaO8S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | sodium [(2S,4R,5R,6R)-4,5,6-trimethoxy-3-methyloxan-2-yl]methyl sulfate |
| SMILES | CO[C@@H]1O[C@H](COS(=O)(=O)[O-])C(C)[C@@H](OC)[C@H]1OC.[Na+] |
| InChI | InChI=1S/C10H20O8S.Na/c1-6-7(5-17-19(11,12)13)18-10(16-4)9(15-3)8(6)14-2;/h6-10H,5H2,1-4H3,(H,11,12,13);/q;+1/p-1/t6?,7-,8-,9-,10-;/m1./s1 |
| InChIKey | JIZSLFVBNIXFPD-HSSBIQHVSA-M |
| XLogP | -3.50 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|