C11H22O5 — CID 176646378
(2R,4S,5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-methyloxane (PubChem CID 176646378) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2R,4S,5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-methyloxane.
| Compound Name | (2R,4S,5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-methyloxane |
|---|---|
| PubChem CID | 176646378 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (2R,4S,5R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-methyloxane |
| SMILES | COCC1O[C@@H](OC)C(OC)[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C11H22O5/c1-7-8(6-12-2)16-11(15-5)10(14-4)9(7)13-3/h7-11H,6H2,1-5H3/t7-,8?,9+,10?,11-/m1/s1 |
| InChIKey | RLHYRJBWXTVSJK-NYBUSTLHSA-N |
| XLogP | 0.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |