C10H21NO5 — CID 24804009
(3R,4R,5S,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-amine (PubChem CID 24804009) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-amine.
| Compound Name | (3R,4R,5S,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-amine |
|---|---|
| PubChem CID | 24804009 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3R,4R,5S,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-amine |
| SMILES | COC[C@H]1OC(OC)[C@H](N)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C10H21NO5/c1-12-5-6-8(13-2)9(14-3)7(11)10(15-4)16-6/h6-10H,5,11H2,1-4H3/t6-,7-,8-,9-,10?/m1/s1 |
| InChIKey | NKOBUKNFLIGQHL-WWGUJXLXSA-N |
| XLogP | -0.64 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |