C12H22O7 — CID 14447784
[(2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl] acetate (PubChem CID 14447784) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 14447784 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl] acetate |
| SMILES | COC[C@H]1O[C@H](OC)[C@H](OC(C)=O)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C12H22O7/c1-7(13)18-11-10(16-4)9(15-3)8(6-14-2)19-12(11)17-5/h8-12H,6H2,1-5H3/t8-,9-,10+,11-,12+/m1/s1 |
| InChIKey | OFTQEFGFTCTXJA-ZIQFBCGOSA-N |
| XLogP | -0.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |