C13H22O8 — CID 22214452
[(2R,3R,4S,5S,6S)-5-acetyloxy-3,4,6-trimethoxyoxan-2-yl]methyl acetate (PubChem CID 22214452) has the molecular formula C13H22O8 and a molecular weight of 306.31 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-5-acetyloxy-3,4,6-trimethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-5-acetyloxy-3,4,6-trimethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22214452 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-5-acetyloxy-3,4,6-trimethoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](COC(C)=O)[C@@H](OC)[C@H](OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H22O8/c1-7(14)19-6-9-10(16-3)11(17-4)12(20-8(2)15)13(18-5)21-9/h9-13H,6H2,1-5H3/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | DRYBXMFUPLEMJC-BNDIWNMDSA-N |
| XLogP | -0.12 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |