C13H27NO5 — CID 24804010
(3R,4R,5S,6R)-2,4,5-triethoxy-6-(methoxymethyl)oxan-3-amine (PubChem CID 24804010) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2,4,5-triethoxy-6-(methoxymethyl)oxan-3-amine.
| Compound Name | (3R,4R,5S,6R)-2,4,5-triethoxy-6-(methoxymethyl)oxan-3-amine |
|---|---|
| PubChem CID | 24804010 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (3R,4R,5S,6R)-2,4,5-triethoxy-6-(methoxymethyl)oxan-3-amine |
| SMILES | CCOC1O[C@H](COC)[C@@H](OCC)[C@H](OCC)[C@H]1N |
| InChI | InChI=1S/C13H27NO5/c1-5-16-11-9(8-15-4)19-13(18-7-3)10(14)12(11)17-6-2/h9-13H,5-8,14H2,1-4H3/t9-,10-,11-,12-,13?/m1/s1 |
| InChIKey | DKADNNCCFASRLO-JVASRFHESA-N |
| XLogP | 0.53 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |