C24H46O13 — CID 101182912
(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyethoxy]ethoxy]oxane (PubChem CID 101182912) has the molecular formula C24H46O13 and a molecular weight of 542.62 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyethoxy]ethoxy]oxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyethoxy]ethoxy]oxane |
|---|---|
| PubChem CID | 101182912 |
| Molecular Formula | C24H46O13 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[2-[2-[(2R,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyethoxy]ethoxy]oxane |
| SMILES | COC[C@H]1O[C@@H](OCCOCCO[C@@H]2O[C@H](COC)[C@H](OC)[C@H](OC)[C@H]2OC)[C@H](OC)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C24H46O13/c1-25-13-15-17(27-3)19(29-5)21(31-7)23(36-15)34-11-9-33-10-12-35-24-22(32-8)20(30-6)18(28-4)16(37-24)14-26-2/h15-24H,9-14H2,1-8H3/t15-,16-,17+,18+,19+,20+,21-,22-,23-,24-/m1/s1 |
| InChIKey | KKXXGTUGTHIQFG-RYMJVJABSA-N |
| XLogP | -0.13 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|