C13H24O6 — CID 59039688
(3S)-3,4,5-trimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane (PubChem CID 59039688) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3S)-3,4,5-trimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane.
| Compound Name | (3S)-3,4,5-trimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 59039688 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3S)-3,4,5-trimethoxy-2-(methoxymethyl)-6-prop-2-enoxyoxane |
| SMILES | C=CCOC1OC(COC)[C@H](OC)C(OC)C1OC |
| InChI | InChI=1S/C13H24O6/c1-6-7-18-13-12(17-5)11(16-4)10(15-3)9(19-13)8-14-2/h6,9-13H,1,7-8H2,2-5H3/t9?,10-,11?,12?,13?/m0/s1 |
| InChIKey | HPTRERBLWMMLHU-SLVBFOELSA-N |
| XLogP | 0.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|