C15H34O6Si2 — CID 22214938
[(2R,3R,4R,5R)-4,5-dimethoxy-2-(methoxymethyl)-6-trimethylsilyloxyoxan-3-yl]oxy-trimethylsilane (PubChem CID 22214938) has the molecular formula C15H34O6Si2 and a molecular weight of 366.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4,5-dimethoxy-2-(methoxymethyl)-6-trimethylsilyloxyoxan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-4,5-dimethoxy-2-(methoxymethyl)-6-trimethylsilyloxyoxan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 22214938 |
| Molecular Formula | C15H34O6Si2 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(2R,3R,4R,5R)-4,5-dimethoxy-2-(methoxymethyl)-6-trimethylsilyloxyoxan-3-yl]oxy-trimethylsilane |
| SMILES | COC[C@H]1OC(O[Si](C)(C)C)[C@H](OC)[C@@H](OC)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O6Si2/c1-16-10-11-12(20-22(4,5)6)13(17-2)14(18-3)15(19-11)21-23(7,8)9/h11-15H,10H2,1-9H3/t11-,12-,13+,14-,15?/m1/s1 |
| InChIKey | SHPLBAHCXKBGSQ-HHHGZCDHSA-N |
| XLogP | 2.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|