C14H29NO6Si — CID 22216013
N-[(2S,3R,4R,5S,6R)-2,4-dimethoxy-6-(methoxymethyl)-5-trimethylsilyloxyoxan-3-yl]acetamide (PubChem CID 22216013) has the molecular formula C14H29NO6Si and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-2,4-dimethoxy-6-(methoxymethyl)-5-trimethylsilyloxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-2,4-dimethoxy-6-(methoxymethyl)-5-trimethylsilyloxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22216013 |
| Molecular Formula | C14H29NO6Si |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2,4-dimethoxy-6-(methoxymethyl)-5-trimethylsilyloxyoxan-3-yl]acetamide |
| SMILES | COC[C@H]1O[C@H](OC)[C@H](NC(C)=O)[C@@H](OC)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H29NO6Si/c1-9(16)15-11-13(18-3)12(21-22(5,6)7)10(8-17-2)20-14(11)19-4/h10-14H,8H2,1-7H3,(H,15,16)/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | WYIXVIWOVILFPU-KSTCHIGDSA-N |
| XLogP | 0.74 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|