C13H24N2O6 — CID 22214877
N-[[(2R,3S,4S,5R)-3-acetamido-4,5,6-trimethoxyoxan-2-yl]methyl]acetamide (PubChem CID 22214877) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is N-[[(2R,3S,4S,5R)-3-acetamido-4,5,6-trimethoxyoxan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R,3S,4S,5R)-3-acetamido-4,5,6-trimethoxyoxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 22214877 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[(2R,3S,4S,5R)-3-acetamido-4,5,6-trimethoxyoxan-2-yl]methyl]acetamide |
| SMILES | COC1O[C@H](CNC(C)=O)[C@H](NC(C)=O)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C13H24N2O6/c1-7(16)14-6-9-10(15-8(2)17)11(18-3)12(19-4)13(20-5)21-9/h9-13H,6H2,1-5H3,(H,14,16)(H,15,17)/t9-,10+,11+,12-,13?/m1/s1 |
| InChIKey | CVQBZLYYFJSZMZ-YMWOCUMHSA-N |
| XLogP | -0.97 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |