C14H24N4O6 — CID 7761458
N-[[(2R,3R,4S,5R,6R)-3,4,5-triacetamido-6-hydroxyoxan-2-yl]methyl]acetamide (PubChem CID 7761458) has the molecular formula C14H24N4O6 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[[(2R,3R,4S,5R,6R)-3,4,5-triacetamido-6-hydroxyoxan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R,3R,4S,5R,6R)-3,4,5-triacetamido-6-hydroxyoxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7761458 |
| Molecular Formula | C14H24N4O6 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[[(2R,3R,4S,5R,6R)-3,4,5-triacetamido-6-hydroxyoxan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1O[C@@H](O)[C@H](NC(C)=O)[C@@H](NC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H24N4O6/c1-6(19)15-5-10-11(16-7(2)20)12(17-8(3)21)13(14(23)24-10)18-9(4)22/h10-14,23H,5H2,1-4H3,(H,15,19)(H,16,20)(H,17,21)(H,18,22)/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | HGTOZNCIKAROQC-MBJXGIAVSA-N |
| XLogP | -2.65 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |