C12H23NO6 — CID 157487416
ethene;N-[(4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 157487416) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethene;N-[(4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | ethene;N-[(4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 157487416 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | ethene;N-[(4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | C=C.C=C.CC(=O)NC1C(O)OC(CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15NO6.2C2H4/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14;2*1-2/h4-8,10,12-14H,2H2,1H3,(H,9,11);2*1-2H2/t4?,5?,6-,7-,8?;;/m0../s1 |
| InChIKey | BWWMLBFNBLYTOC-KRRUEANVSA-N |
| XLogP | -1.47 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|