C8H15NO11S — CID 159096116
N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;trioxathietane 4,4-dioxide (PubChem CID 159096116) has the molecular formula C8H15NO11S and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;trioxathietane 4,4-dioxide.
| Compound Name | N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;trioxathietane 4,4-dioxide |
|---|---|
| PubChem CID | 159096116 |
| Molecular Formula | C8H15NO11S |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide;trioxathietane 4,4-dioxide |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O.O=S1(=O)OOO1 |
| InChI | InChI=1S/C8H15NO6.O5S/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14;1-6(2)4-3-5-6/h4-8,10,12-14H,2H2,1H3,(H,9,11);/t4-,5-,6+,7-,8?;/m1./s1 |
| InChIKey | KCRNGMITEXXVGA-DBKUKYHUSA-N |
| XLogP | -3.95 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|