C20H47NO6Si4 — CID 22217470
N-[(2S,3R,4R,5S,6R)-2,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide (PubChem CID 22217470) has the molecular formula C20H47NO6Si4 and a molecular weight of 509.94 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-2,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-2,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22217470 |
| Molecular Formula | C20H47NO6Si4 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C20H47NO6Si4/c1-15(22)21-17-19(26-30(8,9)10)18(25-29(5,6)7)16(14-23-28(2,3)4)24-20(17)27-31(11,12)13/h16-20H,14H2,1-13H3,(H,21,22)/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | XJUOQAHPURQCIE-OBKDMQGPSA-N |
| XLogP | 4.36 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|