C19H41NO5Si2 — CID 23636276
N-[(2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-3-yl]acetamide (PubChem CID 23636276) has the molecular formula C19H41NO5Si2 and a molecular weight of 419.71 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 23636276 |
| Molecular Formula | C19H41NO5Si2 |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | N-[(2S,3R,4S,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H41NO5Si2/c1-13(22)20-15-16(24-26(8,9)18(2,3)4)14(12-21)23-17(15)25-27(10,11)19(5,6)7/h14-17,21H,12H2,1-11H3,(H,20,22)/t14-,15-,16-,17+/m1/s1 |
| InChIKey | DTJZYELTADRNAB-VQHPVUNQSA-N |
| XLogP | 3.62 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|