C19H42NO8PSi2 — CID 23634559
[(2S,3R,4R,5S)-3-acetamido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 23634559) has the molecular formula C19H42NO8PSi2 and a molecular weight of 499.69 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-3-acetamido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3R,4R,5S)-3-acetamido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 23634559 |
| Molecular Formula | C19H42NO8PSi2 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | [(2S,3R,4R,5S)-3-acetamido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)N[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C19H42NO8PSi2/c1-13(21)20-15-14(12-25-29(22,23)24)26-17(28-31(10,11)19(5,6)7)16(15)27-30(8,9)18(2,3)4/h14-17H,12H2,1-11H3,(H,20,21)(H2,22,23,24)/t14-,15-,16-,17+/m1/s1 |
| InChIKey | JLPPPSXOASJLES-VQHPVUNQSA-N |
| XLogP | 3.74 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|