C7H14NO8P — CID 90992669
[(2S,3R,5R)-3-acetamido-4,5-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90992669) has the molecular formula C7H14NO8P and a molecular weight of 271.16 g/mol. Its IUPAC name is [(2S,3R,5R)-3-acetamido-4,5-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3R,5R)-3-acetamido-4,5-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90992669 |
| Molecular Formula | C7H14NO8P |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [(2S,3R,5R)-3-acetamido-4,5-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)N[C@@H]1C(O)[C@H](O)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C7H14NO8P/c1-3(9)8-5-4(2-15-17(12,13)14)16-7(11)6(5)10/h4-7,10-11H,2H2,1H3,(H,8,9)(H2,12,13,14)/t4-,5+,6?,7-/m1/s1 |
| InChIKey | DGMPMWZYHMPLTK-RDCZQUQVSA-N |
| XLogP | -2.32 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|