C8H15NNaO9P — CID 163304471
sodium (5-acetamido-3,4,6-trihydroxyoxan-2-yl)methyl hydrogen phosphate (PubChem CID 163304471) has the molecular formula C8H15NNaO9P and a molecular weight of 323.17 g/mol. Its IUPAC name is sodium (5-acetamido-3,4,6-trihydroxyoxan-2-yl)methyl hydrogen phosphate.
| Compound Name | sodium (5-acetamido-3,4,6-trihydroxyoxan-2-yl)methyl hydrogen phosphate |
|---|---|
| PubChem CID | 163304471 |
| Molecular Formula | C8H15NNaO9P |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | sodium (5-acetamido-3,4,6-trihydroxyoxan-2-yl)methyl hydrogen phosphate |
| SMILES | CC(=O)NC1C(O)OC(COP(=O)([O-])O)C(O)C1O.[Na+] |
| InChI | InChI=1S/C8H16NO9P.Na/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16;/h4-8,11-13H,2H2,1H3,(H,9,10)(H2,14,15,16);/q;+1/p-1 |
| InChIKey | GFIDKAUZPGVSRH-UHFFFAOYSA-M |
| XLogP | -6.59 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | -6.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|