C6H12O9P- — CID 42609823
[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate (PubChem CID 42609823) has the molecular formula C6H12O9P- and a molecular weight of 259.13 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 42609823 |
| Molecular Formula | C6H12O9P- |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate |
| SMILES | O=P([O-])(O)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/p-1/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | NBSCHQHZLSJFNQ-DVKNGEFBSA-M |
| XLogP | -3.74 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|