C5H11BaO9P — CID 45047075
barium(2+);[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl phosphate;hydrate (PubChem CID 45047075) has the molecular formula C5H11BaO9P and a molecular weight of 383.44 g/mol. Its IUPAC name is barium(2+);[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl phosphate;hydrate.
| Compound Name | barium(2+);[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl phosphate;hydrate |
|---|---|
| PubChem CID | 45047075 |
| Molecular Formula | C5H11BaO9P |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | barium(2+);[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl phosphate;hydrate |
| SMILES | O.O=P([O-])([O-])OC[C@H]1OC(O)[C@H](O)[C@@H]1O.[Ba+2] |
| InChI | InChI=1S/C5H11O8P.Ba.H2O/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7;;/h2-8H,1H2,(H2,9,10,11);;1H2/q;+2;/p-2/t2-,3-,4-,5?;;/m1../s1 |
| InChIKey | BGAROGFQFLJFDO-CHEKPSGWSA-L |
| XLogP | -4.93 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|