C9H19BaO7P — CID 71299662
barium(2+);[(2S,3S,4S,5R)-6-hydroxy-3,4,5-trimethyloxan-2-yl]methyl phosphate;hydrate (PubChem CID 71299662) has the molecular formula C9H19BaO7P and a molecular weight of 407.55 g/mol. Its IUPAC name is barium(2+);[(2S,3S,4S,5R)-6-hydroxy-3,4,5-trimethyloxan-2-yl]methyl phosphate;hydrate.
| Compound Name | barium(2+);[(2S,3S,4S,5R)-6-hydroxy-3,4,5-trimethyloxan-2-yl]methyl phosphate;hydrate |
|---|---|
| PubChem CID | 71299662 |
| Molecular Formula | C9H19BaO7P |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | barium(2+);[(2S,3S,4S,5R)-6-hydroxy-3,4,5-trimethyloxan-2-yl]methyl phosphate;hydrate |
| SMILES | C[C@H]1[C@H](C)[C@@H](C)C(O)O[C@@H]1COP(=O)([O-])[O-].O.[Ba+2] |
| InChI | InChI=1S/C9H19O6P.Ba.H2O/c1-5-6(2)8(4-14-16(11,12)13)15-9(10)7(5)3;;/h5-10H,4H2,1-3H3,(H2,11,12,13);;1H2/q;+2;/p-2/t5-,6-,7+,8+,9?;;/m0../s1 |
| InChIKey | WDLFUYDAJXLQPC-KZXVDCKXSA-L |
| XLogP | -1.75 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|