C27H53O16P3 — CID 158624659
[6-[hydroxy-[(6-hydroxy-3,4,5-trimethyloxan-2-yl)methoxy]phosphoryl]oxy-3,4,5-trimethyloxan-2-yl]methyl [3,4,5-trimethyl-6-(phosphonooxymethyl)oxan-2-yl] hydrogen phosphate (PubChem CID 158624659) has the molecular formula C27H53O16P3 and a molecular weight of 726.63 g/mol. Its IUPAC name is [6-[hydroxy-[(6-hydroxy-3,4,5-trimethyloxan-2-yl)methoxy]phosphoryl]oxy-3,4,5-trimethyloxan-2-yl]methyl [3,4,5-trimethyl-6-(phosphonooxymethyl)oxan-2-yl] hydrogen phosphate.
| Compound Name | [6-[hydroxy-[(6-hydroxy-3,4,5-trimethyloxan-2-yl)methoxy]phosphoryl]oxy-3,4,5-trimethyloxan-2-yl]methyl [3,4,5-trimethyl-6-(phosphonooxymethyl)oxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 158624659 |
| Molecular Formula | C27H53O16P3 |
| Molecular Weight | 726.63 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | [6-[hydroxy-[(6-hydroxy-3,4,5-trimethyloxan-2-yl)methoxy]phosphoryl]oxy-3,4,5-trimethyloxan-2-yl]methyl [3,4,5-trimethyl-6-(phosphonooxymethyl)oxan-2-yl] hydrogen phosphate |
| SMILES | CC1C(O)OC(COP(=O)(O)OC2OC(COP(=O)(O)OC3OC(COP(=O)(O)O)C(C)C(C)C3C)C(C)C(C)C2C)C(C)C1C |
| InChI | InChI=1S/C27H53O16P3/c1-13-16(4)22(39-25(28)19(13)7)11-37-45(32,33)43-27-21(9)15(3)18(6)24(41-27)12-38-46(34,35)42-26-20(8)14(2)17(5)23(40-26)10-36-44(29,30)31/h13-28H,10-12H2,1-9H3,(H,32,33)(H,34,35)(H2,29,30,31) |
| InChIKey | HYKYACCTRREIHY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 226.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|