C7H13O9P-2 — CID 90659314
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl phosphate (PubChem CID 90659314) has the molecular formula C7H13O9P-2 and a molecular weight of 272.15 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl phosphate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 90659314 |
| Molecular Formula | C7H13O9P-2 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl phosphate |
| SMILES | CO[C@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15O9P/c1-14-7-6(10)5(9)4(8)3(16-7)2-15-17(11,12)13/h3-10H,2H2,1H3,(H2,11,12,13)/p-2/t3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | RXYNVAYAPLNZFK-ZFYZTMLRSA-L |
| XLogP | -3.71 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|