C5H11O14P3-2 — CID 171319492
[3,4-dihydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxyoxolan-2-yl]methyl phosphate (PubChem CID 171319492) has the molecular formula C5H11O14P3-2 and a molecular weight of 388.05 g/mol. Its IUPAC name is [3,4-dihydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxyoxolan-2-yl]methyl phosphate.
| Compound Name | [3,4-dihydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 171319492 |
| Molecular Formula | C5H11O14P3-2 |
| Molecular Weight | 388.05 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | [3,4-dihydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxyoxolan-2-yl]methyl phosphate |
| SMILES | O=P([O-])([O-])OCC1OC(OP(=O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C5H13O14P3/c6-3-2(1-16-20(8,9)10)17-5(4(3)7)18-22(14,15)19-21(11,12)13/h2-7H,1H2,(H,14,15)(H2,8,9,10)(H2,11,12,13)/p-2 |
| InChIKey | PQGCEDQWHSBAJP-UHFFFAOYSA-L |
| XLogP | -3.50 |
| TPSA | 235.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.05 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|