C6H14O12P2 — CID 18657738
phosphono [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate (PubChem CID 18657738) has the molecular formula C6H14O12P2 and a molecular weight of 340.11 g/mol. Its IUPAC name is phosphono [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate.
| Compound Name | phosphono [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 18657738 |
| Molecular Formula | C6H14O12P2 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | phosphono [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-1-2-3(8)4(9)5(10)6(16-2)17-20(14,15)18-19(11,12)13/h2-10H,1H2,(H,14,15)(H2,11,12,13)/t2-,3+,4+,5-,6?/m1/s1 |
| InChIKey | GHRQAEPJQRJDHX-SVZMEOIVSA-N |
| XLogP | -2.99 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|