C6H12NaO9P — CID 23716114
sodium [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate (PubChem CID 23716114) has the molecular formula C6H12NaO9P and a molecular weight of 282.12 g/mol. Its IUPAC name is sodium [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate.
| Compound Name | sodium [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 23716114 |
| Molecular Formula | C6H12NaO9P |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | sodium [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| SMILES | O=P([O-])(O)OC1OC(CO)C(O)C(O)C1O.[Na+] |
| InChI | InChI=1S/C6H13O9P.Na/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13;/h2-10H,1H2,(H2,11,12,13);/q;+1/p-1 |
| InChIKey | YSLVOZPKBHMBRV-UHFFFAOYSA-M |
| XLogP | -6.73 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | -6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|