C5H9O8P-2 — CID 20849130
[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate (PubChem CID 20849130) has the molecular formula C5H9O8P-2 and a molecular weight of 228.09 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate.
| Compound Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
|---|---|
| PubChem CID | 20849130 |
| Molecular Formula | C5H9O8P-2 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])OC1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H11O8P/c6-1-2-3(7)4(8)5(12-2)13-14(9,10)11/h2-8H,1H2,(H2,9,10,11)/p-2/t2-,3-,4-,5?/m1/s1 |
| InChIKey | YXJDFQJKERBOBM-SOOFDHNKSA-L |
| XLogP | -3.73 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|