C15H27O16P — CID 22137230
tris[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate (PubChem CID 22137230) has the molecular formula C15H27O16P and a molecular weight of 494.34 g/mol. Its IUPAC name is tris[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate.
| Compound Name | tris[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
|---|---|
| PubChem CID | 22137230 |
| Molecular Formula | C15H27O16P |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | tris[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] phosphate |
| SMILES | O=P(OC1OC(CO)C(O)C1O)(OC1OC(CO)C(O)C1O)OC1OC(CO)C(O)C1O |
| InChI | InChI=1S/C15H27O16P/c16-1-4-7(19)10(22)13(26-4)29-32(25,30-14-11(23)8(20)5(2-17)27-14)31-15-12(24)9(21)6(3-18)28-15/h4-24H,1-3H2 |
| InChIKey | DBRXESFXJTUNRS-UHFFFAOYSA-N |
| XLogP | -5.54 |
| TPSA | 254.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | -5.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|