C5H13O14P3 — CID 87650480
[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] diphosphono phosphate (PubChem CID 87650480) has the molecular formula C5H13O14P3 and a molecular weight of 390.07 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] diphosphono phosphate.
| Compound Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] diphosphono phosphate |
|---|---|
| PubChem CID | 87650480 |
| Molecular Formula | C5H13O14P3 |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | [(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] diphosphono phosphate |
| SMILES | O=P(O)(O)OP(=O)(OC1O[C@H](CO)[C@@H](O)[C@H]1O)OP(=O)(O)O |
| InChI | InChI=1S/C5H13O14P3/c6-1-2-3(7)4(8)5(16-2)17-22(15,18-20(9,10)11)19-21(12,13)14/h2-8H,1H2,(H2,9,10,11)(H2,12,13,14)/t2-,3-,4-,5?/m1/s1 |
| InChIKey | FHLZXSIKHCQWNI-SOOFDHNKSA-N |
| XLogP | -2.23 |
| TPSA | 229.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|