C14H29O9P — CID 151990237
dibutyl [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 151990237) has the molecular formula C14H29O9P and a molecular weight of 372.35 g/mol. Its IUPAC name is dibutyl [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | dibutyl [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 151990237 |
| Molecular Formula | C14H29O9P |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | dibutyl [(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H29O9P/c1-3-5-7-20-24(19,21-8-6-4-2)23-14-13(18)12(17)11(16)10(9-15)22-14/h10-18H,3-9H2,1-2H3/t10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | UENAEDAVDFJRAP-HTOAHKCRSA-N |
| XLogP | 0.54 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|