C9H19O7P — CID 102251717
butyl-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphosphinic acid (PubChem CID 102251717) has the molecular formula C9H19O7P and a molecular weight of 270.22 g/mol. Its IUPAC name is butyl-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphosphinic acid.
| Compound Name | butyl-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 102251717 |
| Molecular Formula | C9H19O7P |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | butyl-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxyphosphinic acid |
| SMILES | CCCCP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H19O7P/c1-2-3-4-17(13,14)16-9-8(12)7(11)6(5-10)15-9/h6-12H,2-5H2,1H3,(H,13,14)/t6-,7-,8-,9-/m1/s1 |
| InChIKey | BZOXMWUHXGJIBT-FNCVBFRFSA-N |
| XLogP | -0.57 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|