C18H33O19P — CID 67063061
tris[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 67063061) has the molecular formula C18H33O19P and a molecular weight of 584.42 g/mol. Its IUPAC name is tris[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | tris[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 67063061 |
| Molecular Formula | C18H33O19P |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | tris[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | O=P(O[C@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O)(O[C@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O)O[C@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H33O19P/c19-1-4-7(22)10(25)13(28)16(32-4)35-38(31,36-17-14(29)11(26)8(23)5(2-20)33-17)37-18-15(30)12(27)9(24)6(3-21)34-18/h4-30H,1-3H2/t4-,5-,6-,7+,8+,9+,10-,11-,12-,13+,14+,15+,16-,17-,18-/m1/s1 |
| InChIKey | IVJLYFLXMGFTLB-YNQCUOKDSA-N |
| XLogP | -7.46 |
| TPSA | 315.21 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|