C7H15O7P — CID 90691668
[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-ethylphosphinic acid (PubChem CID 90691668) has the molecular formula C7H15O7P and a molecular weight of 242.16 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-ethylphosphinic acid.
| Compound Name | [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-ethylphosphinic acid |
|---|---|
| PubChem CID | 90691668 |
| Molecular Formula | C7H15O7P |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-ethylphosphinic acid |
| SMILES | CCP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15O7P/c1-2-15(11,12)14-7-6(10)5(9)4(3-8)13-7/h4-10H,2-3H2,1H3,(H,11,12)/t4-,5-,6-,7+/m1/s1 |
| InChIKey | CUFRDFDYHKQMRM-GBNDHIKLSA-N |
| XLogP | -1.35 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|