C6H11K2O9P — CID 16760444
dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 16760444) has the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. Its IUPAC name is dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 16760444 |
| Molecular Formula | C6H11K2O9P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | dipotassium;[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | O=P([O-])([O-])OC1OC(CO)C(O)C(O)C1O.[K+].[K+] |
| InChI | InChI=1S/C6H13O9P.2K/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13;;/h2-10H,1H2,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | KCIDZIIHRGYJAE-UHFFFAOYSA-L |
| XLogP | -10.36 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -10.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|